C19H18BrN3O4 — CID 4567184
(2-bromophenyl)-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]methanone (PubChem CID 4567184) has the molecular formula C19H18BrN3O4 and a molecular weight of 432.27 g/mol. Its IUPAC name is (2-bromophenyl)-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]methanone.
| Compound Name | (2-bromophenyl)-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]methanone |
|---|---|
| PubChem CID | 4567184 |
| Molecular Formula | C19H18BrN3O4 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (2-bromophenyl)-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]methanone |
| SMILES | COCCOc1nc(-c2ccc(OC)cc2)n(C(=O)c2ccccc2Br)n1 |
| InChI | InChI=1S/C19H18BrN3O4/c1-25-11-12-27-19-21-17(13-7-9-14(26-2)10-8-13)23(22-19)18(24)15-5-3-4-6-16(15)20/h3-10H,11-12H2,1-2H3 |
| InChIKey | BZTZDQOVJZFJLJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|