C22H28N4O3 — CID 93177054
(2R)-1-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol (PubChem CID 93177054) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2R)-1-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol.
| Compound Name | (2R)-1-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 93177054 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2R)-1-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol |
| SMILES | CCOCCOc1nc(-c2ccc(C)cc2)n(-c2ccc(NC[C@@H](C)O)cc2)n1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-28-13-14-29-22-24-21(18-7-5-16(2)6-8-18)26(25-22)20-11-9-19(10-12-20)23-15-17(3)27/h5-12,17,23,27H,4,13-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | CQRUJCNITBFYPC-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|