C26H30N4O4S — CID 46014117
1-[4-[3-(2-ethoxyethoxy)-5-thiophen-2-yl-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol (PubChem CID 46014117) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[4-[3-(2-ethoxyethoxy)-5-thiophen-2-yl-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[4-[3-(2-ethoxyethoxy)-5-thiophen-2-yl-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 46014117 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1-[4-[3-(2-ethoxyethoxy)-5-thiophen-2-yl-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol |
| SMILES | CCOCCOc1nc(-c2cccs2)n(-c2ccc(NCC(O)COCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C26H30N4O4S/c1-2-32-14-15-34-26-28-25(24-9-6-16-35-24)30(29-26)22-12-10-21(11-13-22)27-17-23(31)19-33-18-20-7-4-3-5-8-20/h3-13,16,23,27,31H,2,14-15,17-19H2,1H3 |
| InChIKey | YFOHRUMHFOCWQU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|