C27H29FN4O4 — CID 93177043
(2R)-1-[4-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol (PubChem CID 93177043) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is (2R)-1-[4-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-[4-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 93177043 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (2R)-1-[4-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]anilino]-3-phenylmethoxypropan-2-ol |
| SMILES | COCCOc1nc(-c2ccc(F)cc2)n(-c2ccc(NC[C@@H](O)COCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H29FN4O4/c1-34-15-16-36-27-30-26(21-7-9-22(28)10-8-21)32(31-27)24-13-11-23(12-14-24)29-17-25(33)19-35-18-20-5-3-2-4-6-20/h2-14,25,29,33H,15-19H2,1H3/t25-/m1/s1 |
| InChIKey | BZNWDDGMBCIGKT-RUZDIDTESA-N |
| XLogP | 4.09 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|