C28H27F3N4O3 — CID 42777246
N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-2-phenylbutanamide (PubChem CID 42777246) has the molecular formula C28H27F3N4O3 and a molecular weight of 524.54 g/mol. Its IUPAC name is N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-2-phenylbutanamide.
| Compound Name | N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 42777246 |
| Molecular Formula | C28H27F3N4O3 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)Nc1ccc(-n2nc(OCCOC)nc2-c2ccc(C(F)(F)F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H27F3N4O3/c1-3-24(19-7-5-4-6-8-19)26(36)32-22-13-15-23(16-14-22)35-25(33-27(34-35)38-18-17-37-2)20-9-11-21(12-10-20)28(29,30)31/h4-16,24H,3,17-18H2,1-2H3,(H,32,36) |
| InChIKey | BVOVPZVRVDWHDC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|