About 5-chloro-2-methyl-1-benzothiophene;ethane;propane
5-chloro-2-methyl-1-benzothiophene;ethane;propane (PubChem CID 142538359) has the molecular formula C14H21ClS
and a molecular weight of 256.84 g/mol. Its IUPAC name is 5-chloro-2-methyl-1-benzothiophene;ethane;propane.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-1-benzothiophene;ethane;propane |
| PubChem CID | 142538359 |
| Molecular Formula | C14H21ClS |
| Molecular Weight | 256.84 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-chloro-2-methyl-1-benzothiophene;ethane;propane |
| SMILES | CC.CCC.Cc1cc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C9H7ClS.C3H8.C2H6/c1-6-4-7-5-8(10)2-3-9(7)11-6;1-3-2;1-2/h2-5H,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | WMAFDPYRLUGHBO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.84 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-2-methyl-1-benzothiophene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-1-benzothiophene;ethane;propane?
The IUPAC name of 5-chloro-2-methyl-1-benzothiophene;ethane;propane (CID 142538359) is 5-chloro-2-methyl-1-benzothiophene;ethane;propane.
What is the SMILES notation for 5-chloro-2-methyl-1-benzothiophene;ethane;propane?
The canonical SMILES for 5-chloro-2-methyl-1-benzothiophene;ethane;propane is CC.CCC.Cc1cc2cc(Cl)ccc2s1.
What is the InChIKey of 5-chloro-2-methyl-1-benzothiophene;ethane;propane?
The InChIKey is WMAFDPYRLUGHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClS.C3H8.C2H6/c1-6-4-7-5-8(10)2-3-9(7)11-6;1-3-2;1-2/h2-5H,1H3;3H2,1-2H3;1-2H3.
What are the key properties of 5-chloro-2-methyl-1-benzothiophene;ethane;propane?
5-chloro-2-methyl-1-benzothiophene;ethane;propane has a molecular weight of 256.84 g/mol, XLogP of 6.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-1-benzothiophene;ethane;propane is sourced from PubChem (CID 142538359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).