About ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene
ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene (PubChem CID 143693088) has the molecular formula C15H22OSV
and a molecular weight of 301.35 g/mol. Its IUPAC name is ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene.
Molecular Properties
| Compound Name | ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene |
| PubChem CID | 143693088 |
| Molecular Formula | C15H22OSV |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene |
| SMILES | C=[V].CC.CCCOc1ccc2sc(C)cc2c1 |
| InChI | InChI=1S/C12H14OS.C2H6.CH2.V/c1-3-6-13-11-4-5-12-10(8-11)7-9(2)14-12;1-2;;/h4-5,7-8H,3,6H2,1-2H3;1-2H3;1H2; |
| InChIKey | XVNBUPMZNZJKSV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene?
The IUPAC name of ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene (CID 143693088) is ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene.
What is the SMILES notation for ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene?
The canonical SMILES for ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene is C=[V].CC.CCCOc1ccc2sc(C)cc2c1.
What is the InChIKey of ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene?
The InChIKey is XVNBUPMZNZJKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14OS.C2H6.CH2.V/c1-3-6-13-11-4-5-12-10(8-11)7-9(2)14-12;1-2;;/h4-5,7-8H,3,6H2,1-2H3;1-2H3;1H2;.
What are the key properties of ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene?
ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene has a molecular weight of 301.35 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylidenevanadium;2-methyl-5-propoxy-1-benzothiophene is sourced from PubChem (CID 143693088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).