C23H24F6N2O — CID 142538592
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(3-phenoxyphenyl)methyl]-2,7-diazaspiro[3.5]nonane (PubChem CID 142538592) has the molecular formula C23H24F6N2O and a molecular weight of 458.45 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(3-phenoxyphenyl)methyl]-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(3-phenoxyphenyl)methyl]-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 142538592 |
| Molecular Formula | C23H24F6N2O |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(3-phenoxyphenyl)methyl]-2,7-diazaspiro[3.5]nonane |
| SMILES | FC(F)(F)C(N1CC2(CCN(Cc3cccc(Oc4ccccc4)c3)CC2)C1)C(F)(F)F |
| InChI | InChI=1S/C23H24F6N2O/c24-22(25,26)20(23(27,28)29)31-15-21(16-31)9-11-30(12-10-21)14-17-5-4-8-19(13-17)32-18-6-2-1-3-7-18/h1-8,13,20H,9-12,14-16H2 |
| InChIKey | VKMJCPWERMVCEA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |