C10H12N2O4 — CID 142544179
ethyl (E)-3-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)prop-2-enoate (PubChem CID 142544179) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is ethyl (E)-3-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 142544179 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | ethyl (E)-3-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/n1c(=O)[nH]cc(C)c1=O |
| InChI | InChI=1S/C10H12N2O4/c1-3-16-8(13)4-5-12-9(14)7(2)6-11-10(12)15/h4-6H,3H2,1-2H3,(H,11,15)/b5-4+ |
| InChIKey | QNWIKRMWIJXWJC-SNAWJCMRSA-N |
| XLogP | -0.12 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|