C8H13F2NO — CID 142544254
(3E)-5-amino-3-(fluoromethyl)hexa-1,3,5-trien-2-ol;fluoromethane (PubChem CID 142544254) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is (3E)-5-amino-3-(fluoromethyl)hexa-1,3,5-trien-2-ol;fluoromethane.
| Compound Name | (3E)-5-amino-3-(fluoromethyl)hexa-1,3,5-trien-2-ol;fluoromethane |
|---|---|
| PubChem CID | 142544254 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (3E)-5-amino-3-(fluoromethyl)hexa-1,3,5-trien-2-ol;fluoromethane |
| SMILES | C=C(N)/C=C(/CF)C(=C)O.CF |
| InChI | InChI=1S/C7H10FNO.CH3F/c1-5(9)3-7(4-8)6(2)10;1-2/h3,10H,1-2,4,9H2;1H3/b7-3-; |
| InChIKey | XUEJTFGFYCUBKG-WYLUAFJRSA-N |
| XLogP | 2.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|