C8H12FNO — CID 142545660
(3E)-3-(fluoromethyl)-5-(methylamino)hexa-1,3,5-trien-2-ol (PubChem CID 142545660) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (3E)-3-(fluoromethyl)-5-(methylamino)hexa-1,3,5-trien-2-ol.
| Compound Name | (3E)-3-(fluoromethyl)-5-(methylamino)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 142545660 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (3E)-3-(fluoromethyl)-5-(methylamino)hexa-1,3,5-trien-2-ol |
| SMILES | C=C(/C=C(/CF)C(=C)O)NC |
| InChI | InChI=1S/C8H12FNO/c1-6(10-3)4-8(5-9)7(2)11/h4,10-11H,1-2,5H2,3H3/b8-4- |
| InChIKey | VUWUOAHSBLXCIW-YWEYNIOJSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|