C12H27N5O3 — CID 142545386
ethane;oxolane-3-carbohydrazide;pyrrolidine-1-carbohydrazide (PubChem CID 142545386) has the molecular formula C12H27N5O3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethane;oxolane-3-carbohydrazide;pyrrolidine-1-carbohydrazide.
| Compound Name | ethane;oxolane-3-carbohydrazide;pyrrolidine-1-carbohydrazide |
|---|---|
| PubChem CID | 142545386 |
| Molecular Formula | C12H27N5O3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | ethane;oxolane-3-carbohydrazide;pyrrolidine-1-carbohydrazide |
| SMILES | CC.NNC(=O)C1CCOC1.NNC(=O)N1CCCC1 |
| InChI | InChI=1S/C5H11N3O.C5H10N2O2.C2H6/c6-7-5(9)8-3-1-2-4-8;6-7-5(8)4-1-2-9-3-4;1-2/h1-4,6H2,(H,7,9);4H,1-3,6H2,(H,7,8);1-2H3 |
| InChIKey | KOFCIVHVXMKEIE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|