C28H36N4O4 — CID 142545631
[3-[2-[hydroxy-(9-methyl-10-oxa-8-azatricyclo[5.3.0.01,3]deca-4,8-dien-5-yl)methyl]-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclohexyl]methanediol (PubChem CID 142545631) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is [3-[2-[hydroxy-(9-methyl-10-oxa-8-azatricyclo[5.3.0.01,3]deca-4,8-dien-5-yl)methyl]-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclohexyl]methanediol.
| Compound Name | [3-[2-[hydroxy-(9-methyl-10-oxa-8-azatricyclo[5.3.0.01,3]deca-4,8-dien-5-yl)methyl]-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclohexyl]methanediol |
|---|---|
| PubChem CID | 142545631 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [3-[2-[hydroxy-(9-methyl-10-oxa-8-azatricyclo[5.3.0.01,3]deca-4,8-dien-5-yl)methyl]-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclohexyl]methanediol |
| SMILES | CC1=NC2CC(C(O)c3nc4c5c(ccc4n3C3CCCC(C(O)O)C3)NC(C)CC5)=CC3CC32O1 |
| InChI | InChI=1S/C28H36N4O4/c1-14-6-7-20-21(29-14)8-9-22-24(20)31-26(32(22)19-5-3-4-16(11-19)27(34)35)25(33)17-10-18-13-28(18)23(12-17)30-15(2)36-28/h8-10,14,16,18-19,23,25,27,29,33-35H,3-7,11-13H2,1-2H3 |
| InChIKey | QOOKQJLXRLFLGO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|