C23H27N3O2 — CID 142546108
[3-[(7S)-2-benzyl-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclobutyl]methanediol (PubChem CID 142546108) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [3-[(7S)-2-benzyl-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclobutyl]methanediol.
| Compound Name | [3-[(7S)-2-benzyl-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclobutyl]methanediol |
|---|---|
| PubChem CID | 142546108 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [3-[(7S)-2-benzyl-7-methyl-6,7,8,9-tetrahydroimidazo[4,5-f]quinolin-3-yl]cyclobutyl]methanediol |
| SMILES | C[C@H]1CCc2c(ccc3c2nc(Cc2ccccc2)n3C2CC(C(O)O)C2)N1 |
| InChI | InChI=1S/C23H27N3O2/c1-14-7-8-18-19(24-14)9-10-20-22(18)25-21(11-15-5-3-2-4-6-15)26(20)17-12-16(13-17)23(27)28/h2-6,9-10,14,16-17,23-24,27-28H,7-8,11-13H2,1H3/t14-,16?,17?/m0/s1 |
| InChIKey | SIFRENSRUURPRT-OOHWJJMZSA-N |
| XLogP | 3.64 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|