C17H38N4O3 — CID 142546360
formamide;3-methyl-N-(2-oxobutyl)-2-(propylamino)butanamide;N-methylpropan-1-amine (PubChem CID 142546360) has the molecular formula C17H38N4O3 and a molecular weight of 346.52 g/mol. Its IUPAC name is formamide;3-methyl-N-(2-oxobutyl)-2-(propylamino)butanamide;N-methylpropan-1-amine.
| Compound Name | formamide;3-methyl-N-(2-oxobutyl)-2-(propylamino)butanamide;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 142546360 |
| Molecular Formula | C17H38N4O3 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | formamide;3-methyl-N-(2-oxobutyl)-2-(propylamino)butanamide;N-methylpropan-1-amine |
| SMILES | CCCNC.CCCNC(C(=O)NCC(=O)CC)C(C)C.NC=O |
| InChI | InChI=1S/C12H24N2O2.C4H11N.CH3NO/c1-5-7-13-11(9(3)4)12(16)14-8-10(15)6-2;1-3-4-5-2;2-1-3/h9,11,13H,5-8H2,1-4H3,(H,14,16);5H,3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | PVOIRQBLTFZPSN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|