C16H32N4O4 — CID 71696245
(2S)-N-[(2S)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(propylamino)butanamide (PubChem CID 71696245) has the molecular formula C16H32N4O4 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(propylamino)butanamide.
| Compound Name | (2S)-N-[(2S)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(propylamino)butanamide |
|---|---|
| PubChem CID | 71696245 |
| Molecular Formula | C16H32N4O4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2S)-N-[(2S)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(propylamino)butanamide |
| SMILES | CCCN[C@H](C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)NO)C(C)C)C(C)C |
| InChI | InChI=1S/C16H32N4O4/c1-7-8-17-12(9(2)3)15(22)19-13(10(4)5)16(23)18-11(6)14(21)20-24/h9-13,17,24H,7-8H2,1-6H3,(H,18,23)(H,19,22)(H,20,21)/t11-,12-,13-/m0/s1 |
| InChIKey | HTCBTAXWWSIFHJ-AVGNSLFASA-N |
| XLogP | 0.16 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|