C19H35N5O3 — CID 142547081
1-(2-ethylpentyl)-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one (PubChem CID 142547081) has the molecular formula C19H35N5O3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-(2-ethylpentyl)-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one.
| Compound Name | 1-(2-ethylpentyl)-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 142547081 |
| Molecular Formula | C19H35N5O3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 1-(2-ethylpentyl)-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one |
| SMILES | CCCC(CC)CN1CCN(C2CNNC(=O)C2N2CCOCC2)CC1=O |
| InChI | InChI=1S/C19H35N5O3/c1-3-5-15(4-2)13-24-7-6-23(14-17(24)25)16-12-20-21-19(26)18(16)22-8-10-27-11-9-22/h15-16,18,20H,3-14H2,1-2H3,(H,21,26) |
| InChIKey | PUFVYJIBGKJIQX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |