C20H35N5O3 — CID 168818618
1-[(2-methylcyclohexyl)methyl]-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one (PubChem CID 168818618) has the molecular formula C20H35N5O3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[(2-methylcyclohexyl)methyl]-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one.
| Compound Name | 1-[(2-methylcyclohexyl)methyl]-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 168818618 |
| Molecular Formula | C20H35N5O3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 1-[(2-methylcyclohexyl)methyl]-4-(5-morpholin-4-yl-6-oxodiazinan-4-yl)piperazin-2-one |
| SMILES | CC1CCCCC1CN1CCN(C2CNNC(=O)C2N2CCOCC2)CC1=O |
| InChI | InChI=1S/C20H35N5O3/c1-15-4-2-3-5-16(15)13-25-7-6-24(14-18(25)26)17-12-21-22-20(27)19(17)23-8-10-28-11-9-23/h15-17,19,21H,2-14H2,1H3,(H,22,27) |
| InChIKey | GKGUERMZOKKPBI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |