C19H13F5N2S — CID 142547211
N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-(quinolin-4-ylmethyl)cyclopropanamine (PubChem CID 142547211) has the molecular formula C19H13F5N2S and a molecular weight of 396.38 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-(quinolin-4-ylmethyl)cyclopropanamine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-(quinolin-4-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 142547211 |
| Molecular Formula | C19H13F5N2S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-(quinolin-4-ylmethyl)cyclopropanamine |
| SMILES | Fc1c(F)c(F)c(SN(Cc2ccnc3ccccc23)C2CC2)c(F)c1F |
| InChI | InChI=1S/C19H13F5N2S/c20-14-15(21)17(23)19(18(24)16(14)22)27-26(11-5-6-11)9-10-7-8-25-13-4-2-1-3-12(10)13/h1-4,7-8,11H,5-6,9H2 |
| InChIKey | MRONCMIUMNNOGK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|