C10H19NO — CID 142547581
(3Z)-4-(aminomethyl)-2-methylhexa-1,3,5-trien-3-ol;ethane (PubChem CID 142547581) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (3Z)-4-(aminomethyl)-2-methylhexa-1,3,5-trien-3-ol;ethane.
| Compound Name | (3Z)-4-(aminomethyl)-2-methylhexa-1,3,5-trien-3-ol;ethane |
|---|---|
| PubChem CID | 142547581 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (3Z)-4-(aminomethyl)-2-methylhexa-1,3,5-trien-3-ol;ethane |
| SMILES | C=C/C(CN)=C(/O)C(=C)C.CC |
| InChI | InChI=1S/C8H13NO.C2H6/c1-4-7(5-9)8(10)6(2)3;1-2/h4,10H,1-2,5,9H2,3H3;1-2H3/b8-7-; |
| InChIKey | WWOZJRSXMKHPMX-CFYXSCKTSA-N |
| XLogP | 2.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|