C8H15NO2 — CID 89185801
(3Z,5E)-7-amino-6-methylhepta-3,5-diene-3,4-diol (PubChem CID 89185801) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (3Z,5E)-7-amino-6-methylhepta-3,5-diene-3,4-diol.
| Compound Name | (3Z,5E)-7-amino-6-methylhepta-3,5-diene-3,4-diol |
|---|---|
| PubChem CID | 89185801 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (3Z,5E)-7-amino-6-methylhepta-3,5-diene-3,4-diol |
| SMILES | CC/C(O)=C(O)\C=C(/C)CN |
| InChI | InChI=1S/C8H15NO2/c1-3-7(10)8(11)4-6(2)5-9/h4,10-11H,3,5,9H2,1-2H3/b6-4+,8-7- |
| InChIKey | IIHDBBDPFPDBEW-AQXDOAQYSA-N |
| XLogP | 1.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|