About ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine
ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine (PubChem CID 142549044) has the molecular formula C16H36N4O
and a molecular weight of 300.49 g/mol. Its IUPAC name is ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine.
Molecular Properties
| Compound Name | ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine |
| PubChem CID | 142549044 |
| Molecular Formula | C16H36N4O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine |
| SMILES | CC.CC(=O)N1CCN(C2CCNCC2)CC1.CCCN |
| InChI | InChI=1S/C11H21N3O.C3H9N.C2H6/c1-10(15)13-6-8-14(9-7-13)11-2-4-12-5-3-11;1-2-3-4;1-2/h11-12H,2-9H2,1H3;2-4H2,1H3;1-2H3 |
| InChIKey | SWXKCCIPDUXTLA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine?
The IUPAC name of ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine (CID 142549044) is ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine.
What is the SMILES notation for ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine?
The canonical SMILES for ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine is CC.CC(=O)N1CCN(C2CCNCC2)CC1.CCCN.
What is the InChIKey of ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine?
The InChIKey is SWXKCCIPDUXTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O.C3H9N.C2H6/c1-10(15)13-6-8-14(9-7-13)11-2-4-12-5-3-11;1-2-3-4;1-2/h11-12H,2-9H2,1H3;2-4H2,1H3;1-2H3.
What are the key properties of ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine?
ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine has a molecular weight of 300.49 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-piperidin-4-ylpiperazin-1-yl)ethanone;propan-1-amine is sourced from PubChem (CID 142549044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).