About [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone
[(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone (PubChem CID 170144874) has the molecular formula C16H30N4O
and a molecular weight of 294.44 g/mol. Its IUPAC name is [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone |
| PubChem CID | 170144874 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone |
| SMILES | CC1(C)CNC[C@@H]1C(=O)N1CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C16H30N4O/c1-16(2)12-18-11-14(16)15(21)20-9-7-19(8-10-20)13-3-5-17-6-4-13/h13-14,17-18H,3-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | LQXAPMCLASGKSZ-CQSZACIVSA-N |
| XLogP | 0.13 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone?
The IUPAC name of [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone (CID 170144874) is [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone.
What is the SMILES notation for [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone?
The canonical SMILES for [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone is CC1(C)CNC[C@@H]1C(=O)N1CCN(C2CCNCC2)CC1.
What is the InChIKey of [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone?
The InChIKey is LQXAPMCLASGKSZ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H30N4O/c1-16(2)12-18-11-14(16)15(21)20-9-7-19(8-10-20)13-3-5-17-6-4-13/h13-14,17-18H,3-12H2,1-2H3/t14-/m1/s1.
What are the key properties of [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone?
[(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone has a molecular weight of 294.44 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4,4-dimethylpyrrolidin-3-yl]-(4-piperidin-4-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 170144874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).