C17H33N5O — CID 166945972
[(3R)-1-amino-4,4-dimethylpyrrolidin-3-yl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone (PubChem CID 166945972) has the molecular formula C17H33N5O and a molecular weight of 323.49 g/mol. Its IUPAC name is [(3R)-1-amino-4,4-dimethylpyrrolidin-3-yl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | [(3R)-1-amino-4,4-dimethylpyrrolidin-3-yl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166945972 |
| Molecular Formula | C17H33N5O |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.27 |
| IUPAC Name | [(3R)-1-amino-4,4-dimethylpyrrolidin-3-yl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone |
| SMILES | CN1CCC(N2CCN(C(=O)[C@H]3CN(N)CC3(C)C)CC2)CC1 |
| InChI | InChI=1S/C17H33N5O/c1-17(2)13-22(18)12-15(17)16(23)21-10-8-20(9-11-21)14-4-6-19(3)7-5-14/h14-15H,4-13,18H2,1-3H3/t15-/m1/s1 |
| InChIKey | WOTKLHGULLDWPQ-OAHLLOKOSA-N |
| XLogP | 0.06 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|