C22H24Cl4O3 — CID 142549133
(2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one;ethane (PubChem CID 142549133) has the molecular formula C22H24Cl4O3 and a molecular weight of 478.24 g/mol. Its IUPAC name is (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one;ethane.
| Compound Name | (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one;ethane |
|---|---|
| PubChem CID | 142549133 |
| Molecular Formula | C22H24Cl4O3 |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one;ethane |
| SMILES | CC.O=C1[C@@H](O)OCCCC1(Cc1ccc(Cl)cc1Cl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18Cl4O3.C2H6/c21-14-4-2-12(16(23)8-14)10-20(6-1-7-27-19(26)18(20)25)11-13-3-5-15(22)9-17(13)24;1-2/h2-5,8-9,19,26H,1,6-7,10-11H2;1-2H3/t19-;/m0./s1 |
| InChIKey | AOGMXWNFKZVDPR-FYZYNONXSA-N |
| XLogP | 6.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |