C19H22BrClN2O2 — CID 142549762
4-[[1-(5-bromo-2-methoxyphenyl)-2-methoxyethyl]amino]-3-chlorobenzonitrile;ethane (PubChem CID 142549762) has the molecular formula C19H22BrClN2O2 and a molecular weight of 425.75 g/mol. Its IUPAC name is 4-[[1-(5-bromo-2-methoxyphenyl)-2-methoxyethyl]amino]-3-chlorobenzonitrile;ethane.
| Compound Name | 4-[[1-(5-bromo-2-methoxyphenyl)-2-methoxyethyl]amino]-3-chlorobenzonitrile;ethane |
|---|---|
| PubChem CID | 142549762 |
| Molecular Formula | C19H22BrClN2O2 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 4-[[1-(5-bromo-2-methoxyphenyl)-2-methoxyethyl]amino]-3-chlorobenzonitrile;ethane |
| SMILES | CC.COCC(Nc1ccc(C#N)cc1Cl)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C17H16BrClN2O2.C2H6/c1-22-10-16(13-8-12(18)4-6-17(13)23-2)21-15-5-3-11(9-20)7-14(15)19;1-2/h3-8,16,21H,10H2,1-2H3;1-2H3 |
| InChIKey | IDZOCUUOODXGBP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |