C27H38Cl2N2O2 — CID 142549848
3-chloro-4-[1-(5-chloro-2-ethylphenyl)ethylamino]benzaldehyde;2-[4-(methylaminomethyl)cyclohexyl]ethanol (PubChem CID 142549848) has the molecular formula C27H38Cl2N2O2 and a molecular weight of 493.52 g/mol. Its IUPAC name is 3-chloro-4-[1-(5-chloro-2-ethylphenyl)ethylamino]benzaldehyde;2-[4-(methylaminomethyl)cyclohexyl]ethanol.
| Compound Name | 3-chloro-4-[1-(5-chloro-2-ethylphenyl)ethylamino]benzaldehyde;2-[4-(methylaminomethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 142549848 |
| Molecular Formula | C27H38Cl2N2O2 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-chloro-4-[1-(5-chloro-2-ethylphenyl)ethylamino]benzaldehyde;2-[4-(methylaminomethyl)cyclohexyl]ethanol |
| SMILES | CCc1ccc(Cl)cc1C(C)Nc1ccc(C=O)cc1Cl.CNCC1CCC(CCO)CC1 |
| InChI | InChI=1S/C17H17Cl2NO.C10H21NO/c1-3-13-5-6-14(18)9-15(13)11(2)20-17-7-4-12(10-21)8-16(17)19;1-11-8-10-4-2-9(3-5-10)6-7-12/h4-11,20H,3H2,1-2H3;9-12H,2-8H2,1H3 |
| InChIKey | LVVAGXYFXIGMGG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|