C25H34ClF3N2O4 — CID 142549791
4-[[(2S,3Z)-5-chloro-3-(1-methoxyethenyl)hexa-3,5-dien-2-yl]amino]-3-(trifluoromethyl)benzaldehyde;methanol;3-(methylaminomethyl)cyclobutane-1-carbaldehyde (PubChem CID 142549791) has the molecular formula C25H34ClF3N2O4 and a molecular weight of 519.00 g/mol. Its IUPAC name is 4-[[(2S,3Z)-5-chloro-3-(1-methoxyethenyl)hexa-3,5-dien-2-yl]amino]-3-(trifluoromethyl)benzaldehyde;methanol;3-(methylaminomethyl)cyclobutane-1-carbaldehyde.
| Compound Name | 4-[[(2S,3Z)-5-chloro-3-(1-methoxyethenyl)hexa-3,5-dien-2-yl]amino]-3-(trifluoromethyl)benzaldehyde;methanol;3-(methylaminomethyl)cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 142549791 |
| Molecular Formula | C25H34ClF3N2O4 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-[[(2S,3Z)-5-chloro-3-(1-methoxyethenyl)hexa-3,5-dien-2-yl]amino]-3-(trifluoromethyl)benzaldehyde;methanol;3-(methylaminomethyl)cyclobutane-1-carbaldehyde |
| SMILES | C=C(Cl)/C=C(\C(=C)OC)[C@H](C)Nc1ccc(C=O)cc1C(F)(F)F.CNCC1CC(C=O)C1.CO |
| InChI | InChI=1S/C17H17ClF3NO2.C7H13NO.CH4O/c1-10(18)7-14(12(3)24-4)11(2)22-16-6-5-13(9-23)8-15(16)17(19,20)21;1-8-4-6-2-7(3-6)5-9;1-2/h5-9,11,22H,1,3H2,2,4H3;5-8H,2-4H2,1H3;2H,1H3/b14-7-;;/t11-;;/m0../s1 |
| InChIKey | YLNSHCJFNKTMSB-UNXQZZGFSA-N |
| XLogP | 5.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|