C17H12Cl2F6O2 — CID 159228446
4-chloro-3-(trifluoromethyl)benzaldehyde;1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol (PubChem CID 159228446) has the molecular formula C17H12Cl2F6O2 and a molecular weight of 433.18 g/mol. Its IUPAC name is 4-chloro-3-(trifluoromethyl)benzaldehyde;1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 4-chloro-3-(trifluoromethyl)benzaldehyde;1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 159228446 |
| Molecular Formula | C17H12Cl2F6O2 |
| Molecular Weight | 433.18 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 4-chloro-3-(trifluoromethyl)benzaldehyde;1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(Cl)c(C(F)(F)F)c1.O=Cc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8ClF3O.C8H4ClF3O/c1-5(14)6-2-3-8(10)7(4-6)9(11,12)13;9-7-2-1-5(4-13)3-6(7)8(10,11)12/h2-5,14H,1H3;1-4H |
| InChIKey | KSOWIXHLLPBZRK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.18 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|