C12H14ClF3O — CID 156849313
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-ol (PubChem CID 156849313) has the molecular formula C12H14ClF3O and a molecular weight of 266.69 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-ol.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 156849313 |
| Molecular Formula | C12H14ClF3O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-ol |
| SMILES | CC(C)CC(O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14ClF3O/c1-7(2)5-11(17)8-3-4-10(13)9(6-8)12(14,15)16/h3-4,6-7,11,17H,5H2,1-2H3 |
| InChIKey | IJUMKAVBBFIGNR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |