About (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine
(E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine (PubChem CID 142550138) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine.
Molecular Properties
| Compound Name | (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine |
| PubChem CID | 142550138 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine |
| SMILES | C=CC/N=C/c1ccc(C)cc1.CC/C=C(\C)OC |
| InChI | InChI=1S/C11H13N.C6H12O/c1-3-8-12-9-11-6-4-10(2)5-7-11;1-4-5-6(2)7-3/h3-7,9H,1,8H2,2H3;5H,4H2,1-3H3/b12-9+;6-5+ |
| InChIKey | LNCCSDSLPOLGHH-UXRZMFJYSA-N |
| XLogP | 4.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine?
The IUPAC name of (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine (CID 142550138) is (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine.
What is the SMILES notation for (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine?
The canonical SMILES for (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine is C=CC/N=C/c1ccc(C)cc1.CC/C=C(\C)OC.
What is the InChIKey of (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine?
The InChIKey is LNCCSDSLPOLGHH-UXRZMFJYSA-N. The full InChI is InChI=1S/C11H13N.C6H12O/c1-3-8-12-9-11-6-4-10(2)5-7-11;1-4-5-6(2)7-3/h3-7,9H,1,8H2,2H3;5H,4H2,1-3H3/b12-9+;6-5+.
What are the key properties of (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine?
(E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine has a molecular weight of 259.39 g/mol, XLogP of 4.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methoxypent-2-ene;1-(4-methylphenyl)-N-prop-2-enylmethanimine is sourced from PubChem (CID 142550138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).