C14H28O — CID 142550241
ethane;(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-ol (PubChem CID 142550241) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-ol.
| Compound Name | ethane;(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 142550241 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | ethane;(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dien-1-ol |
| SMILES | C=C(C)/C(=C\C=C(C)C)CO.CC.CC |
| InChI | InChI=1S/C10H16O.2C2H6/c1-8(2)5-6-10(7-11)9(3)4;2*1-2/h5-6,11H,3,7H2,1-2,4H3;2*1-2H3/b10-6-;; |
| InChIKey | ULZQZJPQGJPBIN-LVLXLXDWSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|