C12H20F2O — CID 142553415
(3Z)-2,4-difluoro-3-(2-methylpropoxy)hexa-1,3,5-triene;ethane (PubChem CID 142553415) has the molecular formula C12H20F2O and a molecular weight of 218.29 g/mol. Its IUPAC name is (3Z)-2,4-difluoro-3-(2-methylpropoxy)hexa-1,3,5-triene;ethane.
| Compound Name | (3Z)-2,4-difluoro-3-(2-methylpropoxy)hexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 142553415 |
| Molecular Formula | C12H20F2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (3Z)-2,4-difluoro-3-(2-methylpropoxy)hexa-1,3,5-triene;ethane |
| SMILES | C=C/C(F)=C(/OCC(C)C)C(=C)F.CC |
| InChI | InChI=1S/C10H14F2O.C2H6/c1-5-9(12)10(8(4)11)13-6-7(2)3;1-2/h5,7H,1,4,6H2,2-3H3;1-2H3/b10-9-; |
| InChIKey | LGRHCSZONRFEKG-KVVVOXFISA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|