C27H26FN4O3P — CID 142555409
2-[4-[4-[3-(1-fluoro-1-phosphanylethyl)phenoxy]benzoyl]piperazin-1-yl]-3H-quinazolin-4-one (PubChem CID 142555409) has the molecular formula C27H26FN4O3P and a molecular weight of 504.50 g/mol. Its IUPAC name is 2-[4-[4-[3-(1-fluoro-1-phosphanylethyl)phenoxy]benzoyl]piperazin-1-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[4-[3-(1-fluoro-1-phosphanylethyl)phenoxy]benzoyl]piperazin-1-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 142555409 |
| Molecular Formula | C27H26FN4O3P |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 2-[4-[4-[3-(1-fluoro-1-phosphanylethyl)phenoxy]benzoyl]piperazin-1-yl]-3H-quinazolin-4-one |
| SMILES | CC(F)(P)c1cccc(Oc2ccc(C(=O)N3CCN(c4nc5ccccc5c(=O)[nH]4)CC3)cc2)c1 |
| InChI | InChI=1S/C27H26FN4O3P/c1-27(28,36)19-5-4-6-21(17-19)35-20-11-9-18(10-12-20)25(34)31-13-15-32(16-14-31)26-29-23-8-3-2-7-22(23)24(33)30-26/h2-12,17H,13-16,36H2,1H3,(H,29,30,33) |
| InChIKey | XMFQQJCXMBNKJA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|