C25H20F2N4O2 — CID 138543156
2-[4-[3-(3,5-difluorophenyl)benzoyl]piperazin-1-yl]-3H-quinazolin-4-one (PubChem CID 138543156) has the molecular formula C25H20F2N4O2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[4-[3-(3,5-difluorophenyl)benzoyl]piperazin-1-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[3-(3,5-difluorophenyl)benzoyl]piperazin-1-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138543156 |
| Molecular Formula | C25H20F2N4O2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[4-[3-(3,5-difluorophenyl)benzoyl]piperazin-1-yl]-3H-quinazolin-4-one |
| SMILES | O=C(c1cccc(-c2cc(F)cc(F)c2)c1)N1CCN(c2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C25H20F2N4O2/c26-19-13-18(14-20(27)15-19)16-4-3-5-17(12-16)24(33)30-8-10-31(11-9-30)25-28-22-7-2-1-6-21(22)23(32)29-25/h1-7,12-15H,8-11H2,(H,28,29,32) |
| InChIKey | BVYWHVDMNSJJSA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |