C25H47N3O — CID 142555980
ethane;1-(4-ethoxyphenyl)-4-(1-methylpiperidin-4-yl)-1,4-diazepane;2-methylpropane (PubChem CID 142555980) has the molecular formula C25H47N3O and a molecular weight of 405.67 g/mol. Its IUPAC name is ethane;1-(4-ethoxyphenyl)-4-(1-methylpiperidin-4-yl)-1,4-diazepane;2-methylpropane.
| Compound Name | ethane;1-(4-ethoxyphenyl)-4-(1-methylpiperidin-4-yl)-1,4-diazepane;2-methylpropane |
|---|---|
| PubChem CID | 142555980 |
| Molecular Formula | C25H47N3O |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.37 |
| IUPAC Name | ethane;1-(4-ethoxyphenyl)-4-(1-methylpiperidin-4-yl)-1,4-diazepane;2-methylpropane |
| SMILES | CC.CC(C)C.CCOc1ccc(N2CCCN(C3CCN(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C19H31N3O.C4H10.C2H6/c1-3-23-19-7-5-17(6-8-19)21-11-4-12-22(16-15-21)18-9-13-20(2)14-10-18;1-4(2)3;1-2/h5-8,18H,3-4,9-16H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | MOEBWJCGISAKFJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|