C26H33N7O — CID 142556922
(5R,6S)-5-[1-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]pyrimidin-4-yl]indazol-6-yl]-N,6-dimethylspiro[2.3]hexan-5-amine (PubChem CID 142556922) has the molecular formula C26H33N7O and a molecular weight of 459.60 g/mol. Its IUPAC name is (5R,6S)-5-[1-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]pyrimidin-4-yl]indazol-6-yl]-N,6-dimethylspiro[2.3]hexan-5-amine.
| Compound Name | (5R,6S)-5-[1-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]pyrimidin-4-yl]indazol-6-yl]-N,6-dimethylspiro[2.3]hexan-5-amine |
|---|---|
| PubChem CID | 142556922 |
| Molecular Formula | C26H33N7O |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | (5R,6S)-5-[1-[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]pyrimidin-4-yl]indazol-6-yl]-N,6-dimethylspiro[2.3]hexan-5-amine |
| SMILES | CN[C@]1(c2ccc3cnn(-c4cc(N5CCN6CCOC[C@@H]6C5)ncn4)c3c2)CC2(CC2)[C@@H]1C |
| InChI | InChI=1S/C26H33N7O/c1-18-25(5-6-25)16-26(18,27-2)20-4-3-19-13-30-33(22(19)11-20)24-12-23(28-17-29-24)32-8-7-31-9-10-34-15-21(31)14-32/h3-4,11-13,17-18,21,27H,5-10,14-16H2,1-2H3/t18-,21-,26+/m0/s1 |
| InChIKey | FJYTUYPEORIPHK-RKVCDUFXSA-N |
| XLogP | 2.57 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |