C17H23BN2O3S — CID 142557074
1-[(4-methylsulfinylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 142557074) has the molecular formula C17H23BN2O3S and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-[(4-methylsulfinylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[(4-methylsulfinylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 142557074 |
| Molecular Formula | C17H23BN2O3S |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[(4-methylsulfinylphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CS(=O)c1ccc(Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)cc1 |
| InChI | InChI=1S/C17H23BN2O3S/c1-16(2)17(3,4)23-18(22-16)14-10-19-20(12-14)11-13-6-8-15(9-7-13)24(5)21/h6-10,12H,11H2,1-5H3 |
| InChIKey | RYOPQDVUGCSCQQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|