C29H53N3O3 — CID 142559768
N-(5,5-diaminohexan-2-yl)-4-(3,7-dihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)pentanamide (PubChem CID 142559768) has the molecular formula C29H53N3O3 and a molecular weight of 491.76 g/mol. Its IUPAC name is N-(5,5-diaminohexan-2-yl)-4-(3,7-dihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)pentanamide.
| Compound Name | N-(5,5-diaminohexan-2-yl)-4-(3,7-dihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)pentanamide |
|---|---|
| PubChem CID | 142559768 |
| Molecular Formula | C29H53N3O3 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.41 |
| IUPAC Name | N-(5,5-diaminohexan-2-yl)-4-(3,7-dihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)pentanamide |
| SMILES | CC(CCC(C)(N)N)NC(=O)CCC(C)C1CCC2C1CCC1C2C(O)CC2CC(O)CCC21C |
| InChI | InChI=1S/C29H53N3O3/c1-17(5-10-26(35)32-18(2)11-14-29(4,30)31)21-6-7-23-22(21)8-9-24-27(23)25(34)16-19-15-20(33)12-13-28(19,24)3/h17-25,27,33-34H,5-16,30-31H2,1-4H3,(H,32,35) |
| InChIKey | QHWMOMHIHHXPNM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|