C50H33N5 — CID 142560205
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-3,6-diphenylcarbazole (PubChem CID 142560205) has the molecular formula C50H33N5 and a molecular weight of 703.85 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 142560205 |
| Molecular Formula | C50H33N5 |
| Molecular Weight | 703.85 g/mol |
| Exact Mass | 703.27 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-3,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccc(-c3ccncc3)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C50H33N5/c1-5-13-34(14-6-1)39-21-25-46-43(31-39)44-32-40(35-15-7-2-8-16-35)22-26-47(44)55(46)41-23-24-42(36-27-29-51-30-28-36)45(33-41)50-53-48(37-17-9-3-10-18-37)52-49(54-50)38-19-11-4-12-20-38/h1-33H |
| InChIKey | HGEIGJXVKNVMFI-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.85 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |