C40H29N5 — CID 167261851
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-2,7-dimethylcarbazole (PubChem CID 167261851) has the molecular formula C40H29N5 and a molecular weight of 579.71 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-2,7-dimethylcarbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-2,7-dimethylcarbazole |
|---|---|
| PubChem CID | 167261851 |
| Molecular Formula | C40H29N5 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-4-ylphenyl]-2,7-dimethylcarbazole |
| SMILES | Cc1ccc2c3ccc(C)cc3n(-c3ccc(-c4ccncc4)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2c1 |
| InChI | InChI=1S/C40H29N5/c1-26-13-16-33-34-17-14-27(2)24-37(34)45(36(33)23-26)31-15-18-32(28-19-21-41-22-20-28)35(25-31)40-43-38(29-9-5-3-6-10-29)42-39(44-40)30-11-7-4-8-12-30/h3-25H,1-2H3 |
| InChIKey | VSMLNKGHBGAXMJ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |