C21H21BrN2O4 — CID 1425616
(3R)-3-[2-(3-bromophenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ylmethyl)indol-2-one (PubChem CID 1425616) has the molecular formula C21H21BrN2O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is (3R)-3-[2-(3-bromophenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ylmethyl)indol-2-one.
| Compound Name | (3R)-3-[2-(3-bromophenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 1425616 |
| Molecular Formula | C21H21BrN2O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | (3R)-3-[2-(3-bromophenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ylmethyl)indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(CN2CCOCC2)c2ccccc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H21BrN2O4/c22-16-5-3-4-15(12-16)19(25)13-21(27)17-6-1-2-7-18(17)24(20(21)26)14-23-8-10-28-11-9-23/h1-7,12,27H,8-11,13-14H2/t21-/m1/s1 |
| InChIKey | JXZZDPSZEIIWSX-OAQYLSRUSA-N |
| XLogP | 2.55 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |