C11H14N2 — CID 142562106
5-(C,N-dimethylcarbonimidoyl)-2-methylcyclohexa-1,5-diene-1-carbonitrile (PubChem CID 142562106) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 5-(C,N-dimethylcarbonimidoyl)-2-methylcyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 5-(C,N-dimethylcarbonimidoyl)-2-methylcyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 142562106 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 5-(C,N-dimethylcarbonimidoyl)-2-methylcyclohexa-1,5-diene-1-carbonitrile |
| SMILES | C/N=C(\C)C1=CC(C#N)=C(C)CC1 |
| InChI | InChI=1S/C11H14N2/c1-8-4-5-10(9(2)13-3)6-11(8)7-12/h6H,4-5H2,1-3H3/b13-9+ |
| InChIKey | RIRRMRSRETVTIA-UKTHLTGXSA-N |
| XLogP | 2.64 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|