C26H32FN5O5 — CID 142563771
tert-butyl 4-[2-[4-(4-amino-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]oxyethyl]piperazine-1-carboxylate (PubChem CID 142563771) has the molecular formula C26H32FN5O5 and a molecular weight of 513.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(4-amino-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]oxyethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(4-amino-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]oxyethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142563771 |
| Molecular Formula | C26H32FN5O5 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | tert-butyl 4-[2-[4-(4-amino-2-fluorophenoxy)-6-methoxyquinazolin-7-yl]oxyethyl]piperazine-1-carboxylate |
| SMILES | COc1cc2c(Oc3ccc(N)cc3F)ncnc2cc1OCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H32FN5O5/c1-26(2,3)37-25(33)32-9-7-31(8-10-32)11-12-35-23-15-20-18(14-22(23)34-4)24(30-16-29-20)36-21-6-5-17(28)13-19(21)27/h5-6,13-16H,7-12,28H2,1-4H3 |
| InChIKey | HHYCZBBIYGMTBV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|