C22H24FN7O3 — CID 142564891
2-(2,6-dioxo-5-propan-2-yl-11-pyrrolidin-3-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-(5-fluoro-2-pyridinyl)acetamide (PubChem CID 142564891) has the molecular formula C22H24FN7O3 and a molecular weight of 453.48 g/mol. Its IUPAC name is 2-(2,6-dioxo-5-propan-2-yl-11-pyrrolidin-3-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-(5-fluoro-2-pyridinyl)acetamide.
| Compound Name | 2-(2,6-dioxo-5-propan-2-yl-11-pyrrolidin-3-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-(5-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 142564891 |
| Molecular Formula | C22H24FN7O3 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-(2,6-dioxo-5-propan-2-yl-11-pyrrolidin-3-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-(5-fluoro-2-pyridinyl)acetamide |
| SMILES | CC(C)N1Cc2c(n(CC(=O)Nc3ccc(F)cn3)c3cc(C4CCNC4)nn3c2=O)C1=O |
| InChI | InChI=1S/C22H24FN7O3/c1-12(2)28-10-15-20(22(28)33)29(11-18(31)26-17-4-3-14(23)9-25-17)19-7-16(13-5-6-24-8-13)27-30(19)21(15)32/h3-4,7,9,12-13,24H,5-6,8,10-11H2,1-2H3,(H,25,26,31) |
| InChIKey | VVNVIQUNSNRYLG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|