C24H22FN7O3 — CID 142565156
2-[2,6-dioxo-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide (PubChem CID 142565156) has the molecular formula C24H22FN7O3 and a molecular weight of 475.48 g/mol. Its IUPAC name is 2-[2,6-dioxo-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide.
| Compound Name | 2-[2,6-dioxo-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 142565156 |
| Molecular Formula | C24H22FN7O3 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[2,6-dioxo-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-pyridinyl)acetamide |
| SMILES | CC(C)N1Cc2c(n(CC(=O)Nc3ccc(F)cn3)c3cc(Cc4ccccn4)nn3c2=O)C1=O |
| InChI | InChI=1S/C24H22FN7O3/c1-14(2)30-12-18-22(24(30)35)31(13-20(33)28-19-7-6-15(25)11-27-19)21-10-17(29-32(21)23(18)34)9-16-5-3-4-8-26-16/h3-8,10-11,14H,9,12-13H2,1-2H3,(H,27,28,33) |
| InChIKey | BTXBBJWWHVTASI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|