About ethanamine;4-piperidin-1-ylpyridin-1-ium
ethanamine;4-piperidin-1-ylpyridin-1-ium (PubChem CID 142565329) has the molecular formula C12H22N3+
and a molecular weight of 208.33 g/mol. Its IUPAC name is ethanamine;4-piperidin-1-ylpyridin-1-ium.
Molecular Properties
| Compound Name | ethanamine;4-piperidin-1-ylpyridin-1-ium |
| PubChem CID | 142565329 |
| Molecular Formula | C12H22N3+ |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | ethanamine;4-piperidin-1-ylpyridin-1-ium |
| SMILES | CCN.c1cc(N2CCCCC2)cc[nH+]1 |
| InChI | InChI=1S/C10H14N2.C2H7N/c1-2-8-12(9-3-1)10-4-6-11-7-5-10;1-2-3/h4-7H,1-3,8-9H2;2-3H2,1H3/p+1 |
| InChIKey | ZNNUAOOICGHDKP-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 43.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanamine;4-piperidin-1-ylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;4-piperidin-1-ylpyridin-1-ium?
The IUPAC name of ethanamine;4-piperidin-1-ylpyridin-1-ium (CID 142565329) is ethanamine;4-piperidin-1-ylpyridin-1-ium.
What is the SMILES notation for ethanamine;4-piperidin-1-ylpyridin-1-ium?
The canonical SMILES for ethanamine;4-piperidin-1-ylpyridin-1-ium is CCN.c1cc(N2CCCCC2)cc[nH+]1.
What is the InChIKey of ethanamine;4-piperidin-1-ylpyridin-1-ium?
The InChIKey is ZNNUAOOICGHDKP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H14N2.C2H7N/c1-2-8-12(9-3-1)10-4-6-11-7-5-10;1-2-3/h4-7H,1-3,8-9H2;2-3H2,1H3/p+1.
What are the key properties of ethanamine;4-piperidin-1-ylpyridin-1-ium?
ethanamine;4-piperidin-1-ylpyridin-1-ium has a molecular weight of 208.33 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;4-piperidin-1-ylpyridin-1-ium is sourced from PubChem (CID 142565329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).