About 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole
5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole (PubChem CID 142566266) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole.
Analyze 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole (CID 142566266) is 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole is CC1=NOC(C2CC2)C1.
What is the InChIKey of 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole?
The InChIKey is UXZHQZIJTSWICI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-5-4-7(9-8-5)6-2-3-6/h6-7H,2-4H2,1H3.
What are the key properties of 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole?
5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole has a molecular weight of 125.17 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-3-methyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 142566266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).