C12H10BrFN2O2S — CID 142566608
N-(2-bromo-3-fluorophenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 142566608) has the molecular formula C12H10BrFN2O2S and a molecular weight of 345.19 g/mol. Its IUPAC name is N-(2-bromo-3-fluorophenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | N-(2-bromo-3-fluorophenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 142566608 |
| Molecular Formula | C12H10BrFN2O2S |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | N-(2-bromo-3-fluorophenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | O=C1NCCC(O)=C1C(=S)Nc1cccc(F)c1Br |
| InChI | InChI=1S/C12H10BrFN2O2S/c13-10-6(14)2-1-3-7(10)16-12(19)9-8(17)4-5-15-11(9)18/h1-3,17H,4-5H2,(H,15,18)(H,16,19) |
| InChIKey | JZBSREBOSRBDCO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|