C13H12ClFN2O3S — CID 155071848
N-(3-chloro-4-fluoro-2-methoxyphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 155071848) has the molecular formula C13H12ClFN2O3S and a molecular weight of 330.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluoro-2-methoxyphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | N-(3-chloro-4-fluoro-2-methoxyphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 155071848 |
| Molecular Formula | C13H12ClFN2O3S |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-(3-chloro-4-fluoro-2-methoxyphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | COc1c(NC(=S)C2=C(O)CCNC2=O)ccc(F)c1Cl |
| InChI | InChI=1S/C13H12ClFN2O3S/c1-20-11-7(3-2-6(15)10(11)14)17-13(21)9-8(18)4-5-16-12(9)19/h2-3,18H,4-5H2,1H3,(H,16,19)(H,17,21) |
| InChIKey | YCZGIRONLMYTCC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|